C18H24ClF3N4O2 — CID 176676767
(E)-4-(6-chloro-2-pyridinyl)-N,2-dimethylbut-2-enamide;1-[2-(trifluoromethyl)piperazin-1-yl]ethanone (PubChem CID 176676767) has the molecular formula C18H24ClF3N4O2 and a molecular weight of 420.86 g/mol. Its IUPAC name is (E)-4-(6-chloro-2-pyridinyl)-N,2-dimethylbut-2-enamide;1-[2-(trifluoromethyl)piperazin-1-yl]ethanone.
| Compound Name | (E)-4-(6-chloro-2-pyridinyl)-N,2-dimethylbut-2-enamide;1-[2-(trifluoromethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 176676767 |
| Molecular Formula | C18H24ClF3N4O2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (E)-4-(6-chloro-2-pyridinyl)-N,2-dimethylbut-2-enamide;1-[2-(trifluoromethyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCNCC1C(F)(F)F.CNC(=O)/C(C)=C/Cc1cccc(Cl)n1 |
| InChI | InChI=1S/C11H13ClN2O.C7H11F3N2O/c1-8(11(15)13-2)6-7-9-4-3-5-10(12)14-9;1-5(13)12-3-2-11-4-6(12)7(8,9)10/h3-6H,7H2,1-2H3,(H,13,15);6,11H,2-4H2,1H3/b8-6+; |
| InChIKey | KJPHVNBCZZCNNK-WVLIHFOGSA-N |
| XLogP | 2.34 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|