C26H36N6O3S3 — CID 176678189
tert-butyl 6-[4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-thiazine-6-carbonyl]-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate;(methyldisulfanyl)methane (PubChem CID 176678189) has the molecular formula C26H36N6O3S3 and a molecular weight of 576.81 g/mol. Its IUPAC name is tert-butyl 6-[4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-thiazine-6-carbonyl]-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate;(methyldisulfanyl)methane.
| Compound Name | tert-butyl 6-[4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-thiazine-6-carbonyl]-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate;(methyldisulfanyl)methane |
|---|---|
| PubChem CID | 176678189 |
| Molecular Formula | C26H36N6O3S3 |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | tert-butyl 6-[4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-thiazine-6-carbonyl]-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate;(methyldisulfanyl)methane |
| SMILES | CSSC.Cc1c[nH]c2ncnc(N3C=C(C(=O)N4CC5=C(C4)N(C(=O)OC(C)(C)C)CCC5)SCC3)c12 |
| InChI | InChI=1S/C24H30N6O3S.C2H6S2/c1-15-10-25-20-19(15)21(27-14-26-20)28-8-9-34-18(13-28)22(31)29-11-16-6-5-7-30(17(16)12-29)23(32)33-24(2,3)4;1-3-4-2/h10,13-14H,5-9,11-12H2,1-4H3,(H,25,26,27);1-2H3 |
| InChIKey | JUWBTNWOYDFXTM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|