About 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane
5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane (PubChem CID 176679300) has the molecular formula C9H18N2OS
and a molecular weight of 202.32 g/mol. Its IUPAC name is 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane.
Molecular Properties
| Compound Name | 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane |
| PubChem CID | 176679300 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane |
| SMILES | CCc1ccc(NC)nc1OC.S.[H][H] |
| InChI | InChI=1S/C9H14N2O.H2S.H2/c1-4-7-5-6-8(10-2)11-9(7)12-3;;/h5-6H,4H2,1-3H3,(H,10,11);1H2;1H |
| InChIKey | HFGNPDMGDZZBSW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane?
The IUPAC name of 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane (CID 176679300) is 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane.
What is the SMILES notation for 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane?
The canonical SMILES for 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane is CCc1ccc(NC)nc1OC.S.[H][H].
What is the InChIKey of 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane?
The InChIKey is HFGNPDMGDZZBSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.H2S.H2/c1-4-7-5-6-8(10-2)11-9(7)12-3;;/h5-6H,4H2,1-3H3,(H,10,11);1H2;1H.
What are the key properties of 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane?
5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane has a molecular weight of 202.32 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-methoxy-N-methylpyridin-2-amine;molecular hydrogen;sulfane is sourced from PubChem (CID 176679300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).