C21H14Cl2F3NO3 — CID 176680395
2-[3,5-dichloro-4-[[4-hydroxy-3-(3,4,5-trifluorophenyl)phenyl]methyl]phenoxy]acetamide (PubChem CID 176680395) has the molecular formula C21H14Cl2F3NO3 and a molecular weight of 456.25 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[4-hydroxy-3-(3,4,5-trifluorophenyl)phenyl]methyl]phenoxy]acetamide.
| Compound Name | 2-[3,5-dichloro-4-[[4-hydroxy-3-(3,4,5-trifluorophenyl)phenyl]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 176680395 |
| Molecular Formula | C21H14Cl2F3NO3 |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[[4-hydroxy-3-(3,4,5-trifluorophenyl)phenyl]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1cc(Cl)c(Cc2ccc(O)c(-c3cc(F)c(F)c(F)c3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2F3NO3/c22-15-7-12(30-9-20(27)29)8-16(23)14(15)4-10-1-2-19(28)13(3-10)11-5-17(24)21(26)18(25)6-11/h1-3,5-8,28H,4,9H2,(H2,27,29) |
| InChIKey | FTRLLYAHGOZORQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|