C13H13NO2 — CID 176681559
3-(hydroxymethyl)-6-(3-methylphenyl)-1H-pyridin-2-one (PubChem CID 176681559) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(hydroxymethyl)-6-(3-methylphenyl)-1H-pyridin-2-one.
| Compound Name | 3-(hydroxymethyl)-6-(3-methylphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 176681559 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-(hydroxymethyl)-6-(3-methylphenyl)-1H-pyridin-2-one |
| SMILES | Cc1cccc(-c2ccc(CO)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C13H13NO2/c1-9-3-2-4-10(7-9)12-6-5-11(8-15)13(16)14-12/h2-7,15H,8H2,1H3,(H,14,16) |
| InChIKey | CKIKXQMPSALOOX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |