C14H14ClNO — CID 82520164
3-(chloromethyl)-6-(3,4-dimethylphenyl)-1H-pyridin-2-one (PubChem CID 82520164) has the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. Its IUPAC name is 3-(chloromethyl)-6-(3,4-dimethylphenyl)-1H-pyridin-2-one.
| Compound Name | 3-(chloromethyl)-6-(3,4-dimethylphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82520164 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-(chloromethyl)-6-(3,4-dimethylphenyl)-1H-pyridin-2-one |
| SMILES | Cc1ccc(-c2ccc(CCl)c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C14H14ClNO/c1-9-3-4-11(7-10(9)2)13-6-5-12(8-15)14(17)16-13/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | MKXJAZDVJCAXFP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|