C22H22Cl3N3O — CID 21404555
3-(chloromethyl)-6-[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]-1H-pyridin-2-one;hydrochloride (PubChem CID 21404555) has the molecular formula C22H22Cl3N3O and a molecular weight of 450.80 g/mol. Its IUPAC name is 3-(chloromethyl)-6-[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]-1H-pyridin-2-one;hydrochloride.
| Compound Name | 3-(chloromethyl)-6-[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]-1H-pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 21404555 |
| Molecular Formula | C22H22Cl3N3O |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 3-(chloromethyl)-6-[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]-1H-pyridin-2-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c(-c2ccc(N3CCN(c4cccc(Cl)c4)CC3)cc2)ccc1CCl |
| InChI | InChI=1S/C22H21Cl2N3O.ClH/c23-15-17-6-9-21(25-22(17)28)16-4-7-19(8-5-16)26-10-12-27(13-11-26)20-3-1-2-18(24)14-20;/h1-9,14H,10-13,15H2,(H,25,28);1H |
| InChIKey | UTFRRESYIOLREQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|