C32H21N3OS — CID 176682213
2-[3,5,5-trimethyl-4-[(E)-2-(3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11(22),12,14(21),15,17,19-decaen-4-yl)ethenyl]furan-2-ylidene]propanedinitrile (PubChem CID 176682213) has the molecular formula C32H21N3OS and a molecular weight of 495.61 g/mol. Its IUPAC name is 2-[3,5,5-trimethyl-4-[(E)-2-(3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11(22),12,14(21),15,17,19-decaen-4-yl)ethenyl]furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3,5,5-trimethyl-4-[(E)-2-(3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11(22),12,14(21),15,17,19-decaen-4-yl)ethenyl]furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 176682213 |
| Molecular Formula | C32H21N3OS |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-[3,5,5-trimethyl-4-[(E)-2-(3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11(22),12,14(21),15,17,19-decaen-4-yl)ethenyl]furan-2-ylidene]propanedinitrile |
| SMILES | CC1=C(/C=C/c2cc3c4cccc5ccc6c7ccccc7n(c3s2)c6c54)C(C)(C)OC1=C(C#N)C#N |
| InChI | InChI=1S/C32H21N3OS/c1-18-26(32(2,3)36-30(18)20(16-33)17-34)14-12-21-15-25-23-9-6-7-19-11-13-24-22-8-4-5-10-27(22)35(31(25)37-21)29(24)28(19)23/h4-15H,1-3H3/b14-12+ |
| InChIKey | QPSOIUNYKWSRDE-WYMLVPIESA-N |
| XLogP | 8.49 |
| TPSA | 61.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|