C29H17NO4S2 — CID 176682277
5-(3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14(25),15,17(24),18,20,22-undecaen-6-ylmethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 176682277) has the molecular formula C29H17NO4S2 and a molecular weight of 507.59 g/mol. Its IUPAC name is 5-(3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14(25),15,17(24),18,20,22-undecaen-6-ylmethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14(25),15,17(24),18,20,22-undecaen-6-ylmethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 176682277 |
| Molecular Formula | C29H17NO4S2 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 5-(3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14(25),15,17(24),18,20,22-undecaen-6-ylmethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2cc3sc4c(c5cccc6ccc7c8ccccc8n4c7c65)c3s2)C(=O)O1 |
| InChI | InChI=1S/C29H17NO4S2/c1-29(2)33-27(31)19(28(32)34-29)12-15-13-21-25(35-15)23-18-8-5-6-14-10-11-17-16-7-3-4-9-20(16)30(26(23)36-21)24(17)22(14)18/h3-13H,1-2H3 |
| InChIKey | BLIVHAVTUMVPRS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|