C32H38O6 — CID 176682328
4-[4-(4-formylphenyl)-2,5-bis(6-hydroxyhexoxy)phenyl]benzaldehyde (PubChem CID 176682328) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is 4-[4-(4-formylphenyl)-2,5-bis(6-hydroxyhexoxy)phenyl]benzaldehyde.
| Compound Name | 4-[4-(4-formylphenyl)-2,5-bis(6-hydroxyhexoxy)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 176682328 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 4-[4-(4-formylphenyl)-2,5-bis(6-hydroxyhexoxy)phenyl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2cc(OCCCCCCO)c(-c3ccc(C=O)cc3)cc2OCCCCCCO)cc1 |
| InChI | InChI=1S/C32H38O6/c33-17-5-1-3-7-19-37-31-21-30(28-15-11-26(24-36)12-16-28)32(38-20-8-4-2-6-18-34)22-29(31)27-13-9-25(23-35)10-14-27/h9-16,21-24,33-34H,1-8,17-20H2 |
| InChIKey | DLQCVHBCQLWYEZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|