C13H26N2O2 — CID 176683530
ethane;1-(4-methylpiperazin-1-yl)hexane-1,4-dione (PubChem CID 176683530) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;1-(4-methylpiperazin-1-yl)hexane-1,4-dione.
| Compound Name | ethane;1-(4-methylpiperazin-1-yl)hexane-1,4-dione |
|---|---|
| PubChem CID | 176683530 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;1-(4-methylpiperazin-1-yl)hexane-1,4-dione |
| SMILES | CC.CCC(=O)CCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N2O2.C2H6/c1-3-10(14)4-5-11(15)13-8-6-12(2)7-9-13;1-2/h3-9H2,1-2H3;1-2H3 |
| InChIKey | YKUPJOUYRPDWEW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |