About 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine
1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine (PubChem CID 167474728) has the molecular formula C16H38N4O
and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine.
Molecular Properties
| Compound Name | 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine |
| PubChem CID | 167474728 |
| Molecular Formula | C16H38N4O |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine |
| SMILES | CC.CC.CCC(=O)N1CCN(N)CC1.CN1CCCC1 |
| InChI | InChI=1S/C7H15N3O.C5H11N.2C2H6/c1-2-7(11)9-3-5-10(8)6-4-9;1-6-4-2-3-5-6;2*1-2/h2-6,8H2,1H3;2-5H2,1H3;2*1-2H3 |
| InChIKey | KRVAXKLKGXZUAW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine?
The IUPAC name of 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine (CID 167474728) is 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine.
What is the SMILES notation for 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine?
The canonical SMILES for 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine is CC.CC.CCC(=O)N1CCN(N)CC1.CN1CCCC1.
What is the InChIKey of 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine?
The InChIKey is KRVAXKLKGXZUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O.C5H11N.2C2H6/c1-2-7(11)9-3-5-10(8)6-4-9;1-6-4-2-3-5-6;2*1-2/h2-6,8H2,1H3;2-5H2,1H3;2*1-2H3.
What are the key properties of 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine?
1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine has a molecular weight of 302.51 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminopiperazin-1-yl)propan-1-one;ethane;1-methylpyrrolidine is sourced from PubChem (CID 167474728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).