C21H30N2O2 — CID 176683805
1-[4-[4-[(4-methylpiperidin-1-yl)methyl]piperidine-1-carbonyl]phenyl]ethanone (PubChem CID 176683805) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[4-[4-[(4-methylpiperidin-1-yl)methyl]piperidine-1-carbonyl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[(4-methylpiperidin-1-yl)methyl]piperidine-1-carbonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 176683805 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-[4-[4-[(4-methylpiperidin-1-yl)methyl]piperidine-1-carbonyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC(CN3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O2/c1-16-7-11-22(12-8-16)15-18-9-13-23(14-10-18)21(25)20-5-3-19(4-6-20)17(2)24/h3-6,16,18H,7-15H2,1-2H3 |
| InChIKey | PITKRHFBYHXCTP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |