C19H33N3O2 — CID 176683929
1-[4-[3-[(4-methylpiperazin-1-yl)methyl]pyrrolidine-1-carbonyl]cyclohexyl]ethanone (PubChem CID 176683929) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[4-[3-[(4-methylpiperazin-1-yl)methyl]pyrrolidine-1-carbonyl]cyclohexyl]ethanone.
| Compound Name | 1-[4-[3-[(4-methylpiperazin-1-yl)methyl]pyrrolidine-1-carbonyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 176683929 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 1-[4-[3-[(4-methylpiperazin-1-yl)methyl]pyrrolidine-1-carbonyl]cyclohexyl]ethanone |
| SMILES | CC(=O)C1CCC(C(=O)N2CCC(CN3CCN(C)CC3)C2)CC1 |
| InChI | InChI=1S/C19H33N3O2/c1-15(23)17-3-5-18(6-4-17)19(24)22-8-7-16(14-22)13-21-11-9-20(2)10-12-21/h16-18H,3-14H2,1-2H3 |
| InChIKey | XMRJFNRTVUTIRD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |