C26H32FN7O — CID 176685233
(E)-2-ethenyl-4-[4-[4-[1-(fluoromethyl)cyclopropanecarbonyl]-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile (PubChem CID 176685233) has the molecular formula C26H32FN7O and a molecular weight of 477.59 g/mol. Its IUPAC name is (E)-2-ethenyl-4-[4-[4-[1-(fluoromethyl)cyclopropanecarbonyl]-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile.
| Compound Name | (E)-2-ethenyl-4-[4-[4-[1-(fluoromethyl)cyclopropanecarbonyl]-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
|---|---|
| PubChem CID | 176685233 |
| Molecular Formula | C26H32FN7O |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | (E)-2-ethenyl-4-[4-[4-[1-(fluoromethyl)cyclopropanecarbonyl]-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
| SMILES | C=C/C(C#N)=C\C(=N/C)N1CC2(CCC2)c2c(N3CCN(C(=O)C4(CF)CC4)C(C)C3)ncnc21 |
| InChI | InChI=1S/C26H32FN7O/c1-4-19(13-28)12-20(29-3)34-16-26(6-5-7-26)21-22(30-17-31-23(21)34)32-10-11-33(18(2)14-32)24(35)25(15-27)8-9-25/h4,12,17-18H,1,5-11,14-16H2,2-3H3/b19-12+,29-20+ |
| InChIKey | QFLPQWCVQHBBJH-INUUNXGRSA-N |
| XLogP | 3.17 |
| TPSA | 88.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|