C19H24N6O — CID 91424532
3-[4-methyl-3-[methyl-(2-methyl-6,8,10-triazatricyclo[5.4.0.02,5]undeca-1(7),3,8,10-tetraen-11-yl)amino]piperidin-1-yl]-3-oxopropanenitrile (PubChem CID 91424532) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-[4-methyl-3-[methyl-(2-methyl-6,8,10-triazatricyclo[5.4.0.02,5]undeca-1(7),3,8,10-tetraen-11-yl)amino]piperidin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[4-methyl-3-[methyl-(2-methyl-6,8,10-triazatricyclo[5.4.0.02,5]undeca-1(7),3,8,10-tetraen-11-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 91424532 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 3-[4-methyl-3-[methyl-(2-methyl-6,8,10-triazatricyclo[5.4.0.02,5]undeca-1(7),3,8,10-tetraen-11-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
| SMILES | CC1CCN(C(=O)CC#N)CC1N(C)c1ncnc2c1C1(C)C=CC1N2 |
| InChI | InChI=1S/C19H24N6O/c1-12-6-9-25(15(26)5-8-20)10-13(12)24(3)18-16-17(21-11-22-18)23-14-4-7-19(14,16)2/h4,7,11-14H,5-6,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | ZLBNSRTWJZRCSZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|