C19H17F2N5OS — CID 176685408
N-[(3E)-2-(difluoromethyl)hexa-1,3,5-trien-3-yl]-2-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide (PubChem CID 176685408) has the molecular formula C19H17F2N5OS and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[(3E)-2-(difluoromethyl)hexa-1,3,5-trien-3-yl]-2-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(3E)-2-(difluoromethyl)hexa-1,3,5-trien-3-yl]-2-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 176685408 |
| Molecular Formula | C19H17F2N5OS |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[(3E)-2-(difluoromethyl)hexa-1,3,5-trien-3-yl]-2-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
| SMILES | C=C/C=C(/NC(=O)CSc1nnc2c(n1)[nH]c1ccc(C)cc12)C(=C)C(F)F |
| InChI | InChI=1S/C19H17F2N5OS/c1-4-5-13(11(3)17(20)21)22-15(27)9-28-19-24-18-16(25-26-19)12-8-10(2)6-7-14(12)23-18/h4-8,17H,1,3,9H2,2H3,(H,22,27)(H,23,24,26)/b13-5+ |
| InChIKey | SABBZICJEDUEIE-WLRTZDKTSA-N |
| XLogP | 3.91 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|