C29H40FN3O4 — CID 176686847
3-(4-ethoxyphenyl)-N-[2-[(4-fluorophenyl)methylamino]-2-oxo-1-piperidin-4-ylethyl]-N-(3-methoxypropyl)propanamide (PubChem CID 176686847) has the molecular formula C29H40FN3O4 and a molecular weight of 513.65 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-N-[2-[(4-fluorophenyl)methylamino]-2-oxo-1-piperidin-4-ylethyl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(4-ethoxyphenyl)-N-[2-[(4-fluorophenyl)methylamino]-2-oxo-1-piperidin-4-ylethyl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 176686847 |
| Molecular Formula | C29H40FN3O4 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 3-(4-ethoxyphenyl)-N-[2-[(4-fluorophenyl)methylamino]-2-oxo-1-piperidin-4-ylethyl]-N-(3-methoxypropyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)N(CCCOC)C(C(=O)NCc2ccc(F)cc2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C29H40FN3O4/c1-3-37-26-12-7-22(8-13-26)9-14-27(34)33(19-4-20-36-2)28(24-15-17-31-18-16-24)29(35)32-21-23-5-10-25(30)11-6-23/h5-8,10-13,24,28,31H,3-4,9,14-21H2,1-2H3,(H,32,35) |
| InChIKey | INFBPKSLRULLCD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|