C19H19ClFN3O — CID 176690781
4-chloro-3-[5-fluoro-4-(4-methylcyclohexyl)oxy-2-pyridinyl]-1H-pyrrolo[3,2-c]pyridine (PubChem CID 176690781) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is 4-chloro-3-[5-fluoro-4-(4-methylcyclohexyl)oxy-2-pyridinyl]-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 4-chloro-3-[5-fluoro-4-(4-methylcyclohexyl)oxy-2-pyridinyl]-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 176690781 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-chloro-3-[5-fluoro-4-(4-methylcyclohexyl)oxy-2-pyridinyl]-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CC1CCC(Oc2cc(-c3c[nH]c4ccnc(Cl)c34)ncc2F)CC1 |
| InChI | InChI=1S/C19H19ClFN3O/c1-11-2-4-12(5-3-11)25-17-8-16(24-10-14(17)21)13-9-23-15-6-7-22-19(20)18(13)15/h6-12,23H,2-5H2,1H3 |
| InChIKey | CTMWUJBSZMDWPL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|