C28H42N4 — CID 176691472
(2E,4E,6E)-7-methyl-N-[[(4E)-6-methyl-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine (PubChem CID 176691472) has the molecular formula C28H42N4 and a molecular weight of 434.67 g/mol. Its IUPAC name is (2E,4E,6E)-7-methyl-N-[[(4E)-6-methyl-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6E)-7-methyl-N-[[(4E)-6-methyl-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176691472 |
| Molecular Formula | C28H42N4 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (2E,4E,6E)-7-methyl-N-[[(4E)-6-methyl-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
| SMILES | C/C=C\N=C1/C=C(CNC(=C/C)/C(=C\C=C(/C)CC)N2CCNCC2)C(C)=C/C1=C\CC |
| InChI | InChI=1S/C28H42N4/c1-7-11-24-19-23(6)25(20-27(24)30-14-8-2)21-31-26(10-4)28(13-12-22(5)9-3)32-17-15-29-16-18-32/h8,10-14,19-20,29,31H,7,9,15-18,21H2,1-6H3/b14-8-,22-12+,24-11+,26-10+,28-13+,30-27+ |
| InChIKey | OLUSYDFXJPCWEQ-NSTXHRSTSA-N |
| XLogP | 5.82 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|