C29H31ClFN7O2S — CID 176692126
6-chloro-3-[1-[6-fluoro-3-methyl-2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide (PubChem CID 176692126) has the molecular formula C29H31ClFN7O2S and a molecular weight of 596.13 g/mol. Its IUPAC name is 6-chloro-3-[1-[6-fluoro-3-methyl-2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-[6-fluoro-3-methyl-2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176692126 |
| Molecular Formula | C29H31ClFN7O2S |
| Molecular Weight | 596.13 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 6-chloro-3-[1-[6-fluoro-3-methyl-2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
| SMILES | CSNC(=O)c1nc(Cl)ccc1NC(C)c1cc(F)cc2c(=O)n(C)c(N3CCC(c4ccc(C)nc4)CC3)nc12 |
| InChI | InChI=1S/C29H31ClFN7O2S/c1-16-5-6-19(15-32-16)18-9-11-38(12-10-18)29-35-25-21(13-20(31)14-22(25)28(40)37(29)3)17(2)33-23-7-8-24(30)34-26(23)27(39)36-41-4/h5-8,13-15,17-18,33H,9-12H2,1-4H3,(H,36,39) |
| InChIKey | PRISUJGHOKSIBP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.13 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|