C24H29ClN6O2S — CID 176692268
6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylquinazolin-8-yl)ethylamino]-N-methylsulfanylpyridine-2-carboxamide (PubChem CID 176692268) has the molecular formula C24H29ClN6O2S and a molecular weight of 501.06 g/mol. Its IUPAC name is 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylquinazolin-8-yl)ethylamino]-N-methylsulfanylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylquinazolin-8-yl)ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176692268 |
| Molecular Formula | C24H29ClN6O2S |
| Molecular Weight | 501.06 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 6-chloro-3-[1-(3,6-dimethyl-4-oxo-2-piperidin-1-ylquinazolin-8-yl)ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
| SMILES | CSNC(=O)c1nc(Cl)ccc1NC(C)c1cc(C)cc2c(=O)n(C)c(N3CCCCC3)nc12 |
| InChI | InChI=1S/C24H29ClN6O2S/c1-14-12-16(15(2)26-18-8-9-19(25)27-21(18)22(32)29-34-4)20-17(13-14)23(33)30(3)24(28-20)31-10-6-5-7-11-31/h8-9,12-13,15,26H,5-7,10-11H2,1-4H3,(H,29,32) |
| InChIKey | AIJKWLVMGSGBCF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.06 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|