C25H29ClN6O4S — CID 176692791
6-chloro-3-[1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]-N-(oxetan-3-ylsulfanyl)pyridine-2-carboxamide (PubChem CID 176692791) has the molecular formula C25H29ClN6O4S and a molecular weight of 545.07 g/mol. Its IUPAC name is 6-chloro-3-[1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]-N-(oxetan-3-ylsulfanyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]-N-(oxetan-3-ylsulfanyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176692791 |
| Molecular Formula | C25H29ClN6O4S |
| Molecular Weight | 545.07 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 6-chloro-3-[1-(3,6-dimethyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]-N-(oxetan-3-ylsulfanyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)NSC2COC2)c2nc(N3CCOCC3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H29ClN6O4S/c1-14-10-17(21-18(11-14)24(34)31(3)25(29-21)32-6-8-35-9-7-32)15(2)27-19-4-5-20(26)28-22(19)23(33)30-37-16-12-36-13-16/h4-5,10-11,15-16,27H,6-9,12-13H2,1-3H3,(H,30,33) |
| InChIKey | RUBPETHVJKLTPA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.07 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|