C26H35BF2N4O4S — CID 176694441
CID 176694441 (PubChem CID 176694441) has the molecular formula C26H35BF2N4O4S and a molecular weight of 548.47 g/mol.
| Compound Name | CID 176694441 |
|---|---|
| PubChem CID | 176694441 |
| Molecular Formula | C26H35BF2N4O4S |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | — |
| SMILES | [B]C1=CNC(C)(N2CCCC(F)(F)CC2)C(C(=O)Nc2cccc(S(C)(=O)=NC(=O)OC(C)(C)C)c2)=C1C |
| InChI | InChI=1S/C26H35BF2N4O4S/c1-17-20(27)16-30-25(5,33-13-8-11-26(28,29)12-14-33)21(17)22(34)31-18-9-7-10-19(15-18)38(6,36)32-23(35)37-24(2,3)4/h7,9-10,15-16,30H,8,11-14H2,1-6H3,(H,31,34) |
| InChIKey | NNFKJGUCJNYLHT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|