C12H18N2O3S — CID 169124324
tert-butyl N-[(3-aminophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 169124324) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is tert-butyl N-[(3-aminophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[(3-aminophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 169124324 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | tert-butyl N-[(3-aminophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=[S@](C)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-12(2,3)17-11(15)14-18(4,16)10-7-5-6-9(13)8-10/h5-8H,13H2,1-4H3/t18-/m1/s1 |
| InChIKey | OYNLBAKNGALJIX-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|