C14H20N2O3S — CID 156565766
tert-butyl N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 156565766) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butyl N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 156565766 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | tert-butyl N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(=O)(c1ccc(N)cc1)C1CC1 |
| InChI | InChI=1S/C14H20N2O3S/c1-14(2,3)19-13(17)16-20(18,12-8-9-12)11-6-4-10(15)5-7-11/h4-7,12H,8-9,15H2,1-3H3 |
| InChIKey | CVDZVLAIPMVPEC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|