About tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate
tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 165397471) has the molecular formula C12H15BrFNO3S
and a molecular weight of 352.23 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate |
| PubChem CID | 165397471 |
| Molecular Formula | C12H15BrFNO3S |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFNO3S/c1-12(2,3)18-11(16)15-19(4,17)10-7-8(13)5-6-9(10)14/h5-7H,1-4H3 |
| InChIKey | ASTDCLDRYMRKGK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate?
The IUPAC name of tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate (CID 165397471) is tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate.
What is the SMILES notation for tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate?
The canonical SMILES for tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate is CC(C)(C)OC(=O)N=S(C)(=O)c1cc(Br)ccc1F.
What is the InChIKey of tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate?
The InChIKey is ASTDCLDRYMRKGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrFNO3S/c1-12(2,3)18-11(16)15-19(4,17)10-7-8(13)5-6-9(10)14/h5-7H,1-4H3.
What are the key properties of tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate?
tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate has a molecular weight of 352.23 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(5-bromo-2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 165397471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).