C16H24FN3O3S — CID 140869980
tert-butyl N-[(2-fluoro-6-piperazin-1-ylphenyl)-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 140869980) has the molecular formula C16H24FN3O3S and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl N-[(2-fluoro-6-piperazin-1-ylphenyl)-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[(2-fluoro-6-piperazin-1-ylphenyl)-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 140869980 |
| Molecular Formula | C16H24FN3O3S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | tert-butyl N-[(2-fluoro-6-piperazin-1-ylphenyl)-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=[S@@](C)(=O)c1c(F)cccc1N1CCNCC1 |
| InChI | InChI=1S/C16H24FN3O3S/c1-16(2,3)23-15(21)19-24(4,22)14-12(17)6-5-7-13(14)20-10-8-18-9-11-20/h5-7,18H,8-11H2,1-4H3/t24-/m0/s1 |
| InChIKey | BKBNBAISDQSACK-DEOSSOPVSA-N |
| XLogP | 2.63 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |