About [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid
[(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid (PubChem CID 134499941) has the molecular formula C8H7F2NO3S
and a molecular weight of 235.21 g/mol. Its IUPAC name is [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid.
Analyze [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid?
The IUPAC name of [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid (CID 134499941) is [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid.
What is the SMILES notation for [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid?
The canonical SMILES for [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid is CS(=O)(=NC(=O)O)c1c(F)cccc1F.
What is the InChIKey of [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid?
The InChIKey is SFSHIQKUCLAQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO3S/c1-15(14,11-8(12)13)7-5(9)3-2-4-6(7)10/h2-4H,1H3,(H,12,13).
What are the key properties of [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid?
[(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid has a molecular weight of 235.21 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,6-difluorophenyl)-methyl-oxo-λ6-sulfanylidene]carbamic acid is sourced from PubChem (CID 134499941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).