C24H27N3O4S — CID 170184542
tert-butyl N-[[4-[[2-amino-5-(2-cyclopropylethynyl)phenyl]carbamoyl]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 170184542) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is tert-butyl N-[[4-[[2-amino-5-(2-cyclopropylethynyl)phenyl]carbamoyl]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[4-[[2-amino-5-(2-cyclopropylethynyl)phenyl]carbamoyl]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 170184542 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | tert-butyl N-[[4-[[2-amino-5-(2-cyclopropylethynyl)phenyl]carbamoyl]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)c1ccc(C(=O)Nc2cc(C#CC3CC3)ccc2N)cc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-24(2,3)31-23(29)27-32(4,30)19-12-10-18(11-13-19)22(28)26-21-15-17(9-14-20(21)25)8-7-16-5-6-16/h9-16H,5-6,25H2,1-4H3,(H,26,28) |
| InChIKey | PTZQINBUPWAEDA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|