C22H22FN3O2S — CID 168792625
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-(N-ethyl-S-methylsulfonimidoyl)benzamide (PubChem CID 168792625) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-(N-ethyl-S-methylsulfonimidoyl)benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-(N-ethyl-S-methylsulfonimidoyl)benzamide |
|---|---|
| PubChem CID | 168792625 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-(N-ethyl-S-methylsulfonimidoyl)benzamide |
| SMILES | CCN=S(C)(=O)c1ccc(C(=O)Nc2cc(-c3ccc(F)cc3)ccc2N)cc1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-3-25-29(2,28)19-11-6-16(7-12-19)22(27)26-21-14-17(8-13-20(21)24)15-4-9-18(23)10-5-15/h4-14H,3,24H2,1-2H3,(H,26,27) |
| InChIKey | YCMCAYGVIZVTMV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|