C22H18FN3O2S2 — CID 168792319
N-[2-amino-5-(4-fluorophenyl)phenyl]-5-(methylsulfonimidoyl)-1-benzothiophene-2-carboxamide (PubChem CID 168792319) has the molecular formula C22H18FN3O2S2 and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-5-(methylsulfonimidoyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-5-(methylsulfonimidoyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 168792319 |
| Molecular Formula | C22H18FN3O2S2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-5-(methylsulfonimidoyl)-1-benzothiophene-2-carboxamide |
| SMILES | [H]N=S(C)(=O)c1ccc2sc(C(=O)Nc3cc(-c4ccc(F)cc4)ccc3N)cc2c1 |
| InChI | InChI=1S/C22H18FN3O2S2/c1-30(25,28)17-7-9-20-15(10-17)12-21(29-20)22(27)26-19-11-14(4-8-18(19)24)13-2-5-16(23)6-3-13/h2-12,25H,24H2,1H3,(H,26,27) |
| InChIKey | FBNSYSAZJJVUKS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|