C25H18FN5O2S — CID 168792410
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(6-cyano-3-pyridinyl)sulfonimidoyl]benzamide (PubChem CID 168792410) has the molecular formula C25H18FN5O2S and a molecular weight of 471.52 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(6-cyano-3-pyridinyl)sulfonimidoyl]benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(6-cyano-3-pyridinyl)sulfonimidoyl]benzamide |
|---|---|
| PubChem CID | 168792410 |
| Molecular Formula | C25H18FN5O2S |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(6-cyano-3-pyridinyl)sulfonimidoyl]benzamide |
| SMILES | [H]N=S(=O)(c1ccc(C(=O)Nc2cc(-c3ccc(F)cc3)ccc2N)cc1)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C25H18FN5O2S/c26-19-6-1-16(2-7-19)18-5-12-23(28)24(13-18)31-25(32)17-3-9-21(10-4-17)34(29,33)22-11-8-20(14-27)30-15-22/h1-13,15,29H,28H2,(H,31,32) |
| InChIKey | XJDOTJPWXXVUEH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|