C26H19FN4O2S — CID 170184415
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-ethynyl-3-pyridinyl)sulfonimidoyl]benzamide (PubChem CID 170184415) has the molecular formula C26H19FN4O2S and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-ethynyl-3-pyridinyl)sulfonimidoyl]benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-ethynyl-3-pyridinyl)sulfonimidoyl]benzamide |
|---|---|
| PubChem CID | 170184415 |
| Molecular Formula | C26H19FN4O2S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-ethynyl-3-pyridinyl)sulfonimidoyl]benzamide |
| SMILES | [H]N=S(=O)(c1ccc(C(=O)Nc2cc(-c3ccc(F)cc3)ccc2N)cc1)c1cncc(C#C)c1 |
| InChI | InChI=1S/C26H19FN4O2S/c1-2-17-13-23(16-30-15-17)34(29,33)22-10-5-19(6-11-22)26(32)31-25-14-20(7-12-24(25)28)18-3-8-21(27)9-4-18/h1,3-16,29H,28H2,(H,31,32) |
| InChIKey | JMKFDFRJBODQJN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|