C27H22FN3OS — CID 168913889
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-prop-1-en-2-yl-3-pyridinyl)sulfanyl]benzamide (PubChem CID 168913889) has the molecular formula C27H22FN3OS and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-prop-1-en-2-yl-3-pyridinyl)sulfanyl]benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-prop-1-en-2-yl-3-pyridinyl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 168913889 |
| Molecular Formula | C27H22FN3OS |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-prop-1-en-2-yl-3-pyridinyl)sulfanyl]benzamide |
| SMILES | C=C(C)c1cncc(Sc2ccc(C(=O)Nc3cc(-c4ccc(F)cc4)ccc3N)cc2)c1 |
| InChI | InChI=1S/C27H22FN3OS/c1-17(2)21-13-24(16-30-15-21)33-23-10-5-19(6-11-23)27(32)31-26-14-20(7-12-25(26)29)18-3-8-22(28)9-4-18/h3-16H,1,29H2,2H3,(H,31,32) |
| InChIKey | YOFLUINHHLMTQQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|