C23H21FN4O2S — CID 168913947
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-methyl-2,3-dihydro-1H-imidazol-4-yl)sulfinyl]benzamide (PubChem CID 168913947) has the molecular formula C23H21FN4O2S and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-methyl-2,3-dihydro-1H-imidazol-4-yl)sulfinyl]benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-methyl-2,3-dihydro-1H-imidazol-4-yl)sulfinyl]benzamide |
|---|---|
| PubChem CID | 168913947 |
| Molecular Formula | C23H21FN4O2S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[(5-methyl-2,3-dihydro-1H-imidazol-4-yl)sulfinyl]benzamide |
| SMILES | CC1=C(S(=O)c2ccc(C(=O)Nc3cc(-c4ccc(F)cc4)ccc3N)cc2)NCN1 |
| InChI | InChI=1S/C23H21FN4O2S/c1-14-23(27-13-26-14)31(30)19-9-4-16(5-10-19)22(29)28-21-12-17(6-11-20(21)25)15-2-7-18(24)8-3-15/h2-12,26-27H,13,25H2,1H3,(H,28,29) |
| InChIKey | RHCDYJOZFPTRRU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|