C28H26FN3O3S — CID 168913828
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[5-(2-methoxyethoxymethyl)-3-pyridinyl]sulfanyl]benzamide (PubChem CID 168913828) has the molecular formula C28H26FN3O3S and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[5-(2-methoxyethoxymethyl)-3-pyridinyl]sulfanyl]benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[5-(2-methoxyethoxymethyl)-3-pyridinyl]sulfanyl]benzamide |
|---|---|
| PubChem CID | 168913828 |
| Molecular Formula | C28H26FN3O3S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[5-(2-methoxyethoxymethyl)-3-pyridinyl]sulfanyl]benzamide |
| SMILES | COCCOCc1cncc(Sc2ccc(C(=O)Nc3cc(-c4ccc(F)cc4)ccc3N)cc2)c1 |
| InChI | InChI=1S/C28H26FN3O3S/c1-34-12-13-35-18-19-14-25(17-31-16-19)36-24-9-4-21(5-10-24)28(33)32-27-15-22(6-11-26(27)30)20-2-7-23(29)8-3-20/h2-11,14-17H,12-13,18,30H2,1H3,(H,32,33) |
| InChIKey | VRABSLBMADNFJT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|