C28H27FN4O4S — CID 168792521
N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[6-(2-methoxyethoxymethyl)-3-pyridinyl]sulfonimidoyl]benzamide (PubChem CID 168792521) has the molecular formula C28H27FN4O4S and a molecular weight of 534.61 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[6-(2-methoxyethoxymethyl)-3-pyridinyl]sulfonimidoyl]benzamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[6-(2-methoxyethoxymethyl)-3-pyridinyl]sulfonimidoyl]benzamide |
|---|---|
| PubChem CID | 168792521 |
| Molecular Formula | C28H27FN4O4S |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-4-[[6-(2-methoxyethoxymethyl)-3-pyridinyl]sulfonimidoyl]benzamide |
| SMILES | [H]N=S(=O)(c1ccc(C(=O)Nc2cc(-c3ccc(F)cc3)ccc2N)cc1)c1ccc(COCCOC)nc1 |
| InChI | InChI=1S/C28H27FN4O4S/c1-36-14-15-37-18-23-9-12-25(17-32-23)38(31,35)24-10-4-20(5-11-24)28(34)33-27-16-21(6-13-26(27)30)19-2-7-22(29)8-3-19/h2-13,16-17,31H,14-15,18,30H2,1H3,(H,33,34) |
| InChIKey | GBIGMFOVWPSMHZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|