C20H18FN3O2S — CID 168792492
N-[2-amino-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)phenyl]-4-(methylsulfonimidoyl)benzamide (PubChem CID 168792492) has the molecular formula C20H18FN3O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is N-[2-amino-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)phenyl]-4-(methylsulfonimidoyl)benzamide.
| Compound Name | N-[2-amino-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)phenyl]-4-(methylsulfonimidoyl)benzamide |
|---|---|
| PubChem CID | 168792492 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[2-amino-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)phenyl]-4-(methylsulfonimidoyl)benzamide |
| SMILES | [H]N=S(C)(=O)c1ccc(C(=O)Nc2cc(-c3c([2H])c([2H])c(F)c([2H])c3[2H])ccc2N)cc1 |
| InChI | InChI=1S/C20H18FN3O2S/c1-27(23,26)17-9-4-14(5-10-17)20(25)24-19-12-15(6-11-18(19)22)13-2-7-16(21)8-3-13/h2-12,23H,22H2,1H3,(H,24,25)/i2D,3D,7D,8D |
| InChIKey | JPFMYSJUFUEHBI-FTGRQYFSSA-N |
| XLogP | 4.36 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|