C22H21IN2OS — CID 126723287
[4-[4-amino-3-[(4-propylbenzoyl)amino]phenyl]phenyl] thiohypoiodite (PubChem CID 126723287) has the molecular formula C22H21IN2OS and a molecular weight of 488.39 g/mol. Its IUPAC name is [4-[4-amino-3-[(4-propylbenzoyl)amino]phenyl]phenyl] thiohypoiodite.
| Compound Name | [4-[4-amino-3-[(4-propylbenzoyl)amino]phenyl]phenyl] thiohypoiodite |
|---|---|
| PubChem CID | 126723287 |
| Molecular Formula | C22H21IN2OS |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | [4-[4-amino-3-[(4-propylbenzoyl)amino]phenyl]phenyl] thiohypoiodite |
| SMILES | CCCc1ccc(C(=O)Nc2cc(-c3ccc(SI)cc3)ccc2N)cc1 |
| InChI | InChI=1S/C22H21IN2OS/c1-2-3-15-4-6-17(7-5-15)22(26)25-21-14-18(10-13-20(21)24)16-8-11-19(27-23)12-9-16/h4-14H,2-3,24H2,1H3,(H,25,26) |
| InChIKey | LDNAYUCWKBIABX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|