About tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate
tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 11484209) has the molecular formula C16H26N2O3S
and a molecular weight of 326.46 g/mol. Its IUPAC name is tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate |
| PubChem CID | 11484209 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CCCCNc1ccc(S(C)(=O)=NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-6-7-12-17-13-8-10-14(11-9-13)22(5,20)18-15(19)21-16(2,3)4/h8-11,17H,6-7,12H2,1-5H3 |
| InChIKey | BGOIFWDQGSAOQG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate?
The IUPAC name of tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate (CID 11484209) is tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate.
What is the SMILES notation for tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate?
The canonical SMILES for tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate is CCCCNc1ccc(S(C)(=O)=NC(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate?
The InChIKey is BGOIFWDQGSAOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3S/c1-6-7-12-17-13-8-10-14(11-9-13)22(5,20)18-15(19)21-16(2,3)4/h8-11,17H,6-7,12H2,1-5H3.
What are the key properties of tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate?
tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate has a molecular weight of 326.46 g/mol, XLogP of 4.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[4-(butylamino)phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 11484209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).