C23H26F2N4O2S — CID 176694578
6-(4,4-difluoroazepan-1-yl)-2,2-dimethyl-N-(2-methylsulfanyl-4-pyridinyl)-1,4-benzoxazine-7-carboxamide (PubChem CID 176694578) has the molecular formula C23H26F2N4O2S and a molecular weight of 460.55 g/mol. Its IUPAC name is 6-(4,4-difluoroazepan-1-yl)-2,2-dimethyl-N-(2-methylsulfanyl-4-pyridinyl)-1,4-benzoxazine-7-carboxamide.
| Compound Name | 6-(4,4-difluoroazepan-1-yl)-2,2-dimethyl-N-(2-methylsulfanyl-4-pyridinyl)-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 176694578 |
| Molecular Formula | C23H26F2N4O2S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 6-(4,4-difluoroazepan-1-yl)-2,2-dimethyl-N-(2-methylsulfanyl-4-pyridinyl)-1,4-benzoxazine-7-carboxamide |
| SMILES | CSc1cc(NC(=O)c2cc3c(cc2N2CCCC(F)(F)CC2)N=CC(C)(C)O3)ccn1 |
| InChI | InChI=1S/C23H26F2N4O2S/c1-22(2)14-27-17-13-18(29-9-4-6-23(24,25)7-10-29)16(12-19(17)31-22)21(30)28-15-5-8-26-20(11-15)32-3/h5,8,11-14H,4,6-7,9-10H2,1-3H3,(H,26,28,30) |
| InChIKey | UZGQZDMEWOKIFR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|