C20H23N5OS — CID 176694821
2-(methylsulfanylamino)-1-[3-(6-pyrazolo[1,5-a]pyridin-3-yl-2-pyridinyl)piperidin-1-yl]ethanone (PubChem CID 176694821) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 2-(methylsulfanylamino)-1-[3-(6-pyrazolo[1,5-a]pyridin-3-yl-2-pyridinyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(methylsulfanylamino)-1-[3-(6-pyrazolo[1,5-a]pyridin-3-yl-2-pyridinyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 176694821 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(methylsulfanylamino)-1-[3-(6-pyrazolo[1,5-a]pyridin-3-yl-2-pyridinyl)piperidin-1-yl]ethanone |
| SMILES | CSNCC(=O)N1CCCC(c2cccc(-c3cnn4ccccc34)n2)C1 |
| InChI | InChI=1S/C20H23N5OS/c1-27-22-13-20(26)24-10-5-6-15(14-24)17-7-4-8-18(23-17)16-12-21-25-11-3-2-9-19(16)25/h2-4,7-9,11-12,15,22H,5-6,10,13-14H2,1H3 |
| InChIKey | KRGLKRONZMVQEZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|