C26H41NO3 — CID 176697105
[4-[[2-(3-butyl-2-methylcyclohexyl)-1-hydroxypropoxy]methyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 176697105) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is [4-[[2-(3-butyl-2-methylcyclohexyl)-1-hydroxypropoxy]methyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[2-(3-butyl-2-methylcyclohexyl)-1-hydroxypropoxy]methyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 176697105 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | [4-[[2-(3-butyl-2-methylcyclohexyl)-1-hydroxypropoxy]methyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CCCCC1CCCC(C(C)C(O)OCc2ccc(C(=O)N3CCCC3)cc2)C1C |
| InChI | InChI=1S/C26H41NO3/c1-4-5-9-22-10-8-11-24(19(22)2)20(3)26(29)30-18-21-12-14-23(15-13-21)25(28)27-16-6-7-17-27/h12-15,19-20,22,24,26,29H,4-11,16-18H2,1-3H3 |
| InChIKey | HYIKKGWYLPHSGR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|