C20H31NO — CID 90987266
(4-butylphenyl)-[4-(2-methylpropyl)piperidin-1-yl]methanone (PubChem CID 90987266) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (4-butylphenyl)-[4-(2-methylpropyl)piperidin-1-yl]methanone.
| Compound Name | (4-butylphenyl)-[4-(2-methylpropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90987266 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (4-butylphenyl)-[4-(2-methylpropyl)piperidin-1-yl]methanone |
| SMILES | CCCCc1ccc(C(=O)N2CCC(CC(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31NO/c1-4-5-6-17-7-9-19(10-8-17)20(22)21-13-11-18(12-14-21)15-16(2)3/h7-10,16,18H,4-6,11-15H2,1-3H3 |
| InChIKey | RWESPCTUECLTLP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |