C23H26FNO3 — CID 155531741
(4-butylphenyl)-[1-(4-fluoro-3-hydroxybenzoyl)piperidin-4-yl]methanone (PubChem CID 155531741) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is (4-butylphenyl)-[1-(4-fluoro-3-hydroxybenzoyl)piperidin-4-yl]methanone.
| Compound Name | (4-butylphenyl)-[1-(4-fluoro-3-hydroxybenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 155531741 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (4-butylphenyl)-[1-(4-fluoro-3-hydroxybenzoyl)piperidin-4-yl]methanone |
| SMILES | CCCCc1ccc(C(=O)C2CCN(C(=O)c3ccc(F)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C23H26FNO3/c1-2-3-4-16-5-7-17(8-6-16)22(27)18-11-13-25(14-12-18)23(28)19-9-10-20(24)21(26)15-19/h5-10,15,18,26H,2-4,11-14H2,1H3 |
| InChIKey | ZHQIHJFXLFNJRR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |