C26H31NO5 — CID 130193111
[2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl] 4-butylbenzoate (PubChem CID 130193111) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is [2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl] 4-butylbenzoate.
| Compound Name | [2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl] 4-butylbenzoate |
|---|---|
| PubChem CID | 130193111 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OCC(=O)N2CCC(C(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-3-4-5-19-6-8-22(9-7-19)26(30)32-18-24(28)27-16-14-21(15-17-27)25(29)20-10-12-23(31-2)13-11-20/h6-13,21H,3-5,14-18H2,1-2H3 |
| InChIKey | IXDNNUHCZPHTNF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |