C30H35N3O2 — CID 176698635
N-[1-(6-amino-2-pyridinyl)ethyl]-5-(4-tert-butylphenoxy)naphthalene-2-carboxamide;ethane (PubChem CID 176698635) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[1-(6-amino-2-pyridinyl)ethyl]-5-(4-tert-butylphenoxy)naphthalene-2-carboxamide;ethane.
| Compound Name | N-[1-(6-amino-2-pyridinyl)ethyl]-5-(4-tert-butylphenoxy)naphthalene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 176698635 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | N-[1-(6-amino-2-pyridinyl)ethyl]-5-(4-tert-butylphenoxy)naphthalene-2-carboxamide;ethane |
| SMILES | CC.CC(NC(=O)c1ccc2c(Oc3ccc(C(C)(C)C)cc3)cccc2c1)c1cccc(N)n1 |
| InChI | InChI=1S/C28H29N3O2.C2H6/c1-18(24-8-6-10-26(29)31-24)30-27(32)20-11-16-23-19(17-20)7-5-9-25(23)33-22-14-12-21(13-15-22)28(2,3)4;1-2/h5-18H,1-4H3,(H2,29,31)(H,30,32);1-2H3 |
| InChIKey | RBNYMBXWBONPMC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |