C27H36N6O2 — CID 176700036
N,N'-diamino-3-[3-[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]oxyphenyl]-2,1-benzoxazole-5-carboximidamide (PubChem CID 176700036) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is N,N'-diamino-3-[3-[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]oxyphenyl]-2,1-benzoxazole-5-carboximidamide.
| Compound Name | N,N'-diamino-3-[3-[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]oxyphenyl]-2,1-benzoxazole-5-carboximidamide |
|---|---|
| PubChem CID | 176700036 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | N,N'-diamino-3-[3-[1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]oxyphenyl]-2,1-benzoxazole-5-carboximidamide |
| SMILES | CC1CCC(CN2CCC(Oc3cccc(-c4onc5ccc(C(=NN)NN)cc45)c3)CC2)CC1 |
| InChI | InChI=1S/C27H36N6O2/c1-18-5-7-19(8-6-18)17-33-13-11-22(12-14-33)34-23-4-2-3-20(15-23)26-24-16-21(27(30-28)31-29)9-10-25(24)32-35-26/h2-4,9-10,15-16,18-19,22H,5-8,11-14,17,28-29H2,1H3,(H,30,31) |
| InChIKey | HTZAOEXVIKUCRB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|