C19H32FNO3 — CID 176700323
2-cyclobutyl-N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]acetamide;ethane (PubChem CID 176700323) has the molecular formula C19H32FNO3 and a molecular weight of 341.47 g/mol. Its IUPAC name is 2-cyclobutyl-N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]acetamide;ethane.
| Compound Name | 2-cyclobutyl-N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]acetamide;ethane |
|---|---|
| PubChem CID | 176700323 |
| Molecular Formula | C19H32FNO3 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 2-cyclobutyl-N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]acetamide;ethane |
| SMILES | C=C(F)/C=C(/OCCOCCNC(=O)CC1CCC1)C(=C)C.CC |
| InChI | InChI=1S/C17H26FNO3.C2H6/c1-13(2)16(11-14(3)18)22-10-9-21-8-7-19-17(20)12-15-5-4-6-15;1-2/h11,15H,1,3-10,12H2,2H3,(H,19,20);1-2H3/b16-11+; |
| InChIKey | MWNCVDVAJAQJQH-YFMOEUEHSA-N |
| XLogP | 4.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|